C22H13ClN4O6S — CID 137100063
(5Z)-2-(4-chlorophenyl)imino-5-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137100063) has the molecular formula C22H13ClN4O6S and a molecular weight of 496.89 g/mol. Its IUPAC name is (5Z)-2-(4-chlorophenyl)imino-5-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-chlorophenyl)imino-5-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137100063 |
| Molecular Formula | C22H13ClN4O6S |
| Molecular Weight | 496.89 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | (5Z)-2-(4-chlorophenyl)imino-5-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccc(Cl)cc2)S/C1=C\c1ccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H13ClN4O6S/c23-14-3-5-15(6-4-14)24-22-25-21(28)20(34-22)11-13-1-8-17(9-2-13)33-19-10-7-16(26(29)30)12-18(19)27(31)32/h1-12H,(H,24,25,28)/b20-11- |
| InChIKey | XKJXSQYXPHMEFF-JAIQZWGSSA-N |
| XLogP | 5.84 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.89 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|