C23H14ClN3O5S — CID 137021311
[4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 2-nitrobenzoate (PubChem CID 137021311) has the molecular formula C23H14ClN3O5S and a molecular weight of 479.90 g/mol. Its IUPAC name is [4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 2-nitrobenzoate.
| Compound Name | [4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 137021311 |
| Molecular Formula | C23H14ClN3O5S |
| Molecular Weight | 479.90 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | [4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 2-nitrobenzoate |
| SMILES | O=C1N/C(=N\c2ccc(Cl)cc2)S/C1=C\c1ccc(OC(=O)c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H14ClN3O5S/c24-15-7-9-16(10-8-15)25-23-26-21(28)20(33-23)13-14-5-11-17(12-6-14)32-22(29)18-3-1-2-4-19(18)27(30)31/h1-13H,(H,25,26,28)/b20-13- |
| InChIKey | BXERTUZNABVJAQ-MOSHPQCFSA-N |
| XLogP | 5.36 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.90 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|