C23H14BrClN2O3S — CID 137044112
[4-[(Z)-[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-chlorobenzoate (PubChem CID 137044112) has the molecular formula C23H14BrClN2O3S and a molecular weight of 513.80 g/mol. Its IUPAC name is [4-[(Z)-[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-chlorobenzoate.
| Compound Name | [4-[(Z)-[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 137044112 |
| Molecular Formula | C23H14BrClN2O3S |
| Molecular Weight | 513.80 g/mol |
| Exact Mass | 511.96 |
| IUPAC Name | [4-[(Z)-[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-chlorobenzoate |
| SMILES | O=C1N/C(=N\c2ccc(Br)cc2)S/C1=C\c1ccc(OC(=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C23H14BrClN2O3S/c24-16-6-8-18(9-7-16)26-23-27-21(28)20(31-23)12-14-4-10-19(11-5-14)30-22(29)15-2-1-3-17(25)13-15/h1-13H,(H,26,27,28)/b20-12- |
| InChIKey | LUBWGBBFCMQKAV-NDENLUEZSA-N |
| XLogP | 6.21 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.80 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|