C24H17ClN2O4S — CID 137021490
[4-[(Z)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-chlorobenzoate (PubChem CID 137021490) has the molecular formula C24H17ClN2O4S and a molecular weight of 464.93 g/mol. Its IUPAC name is [4-[(Z)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-chlorobenzoate.
| Compound Name | [4-[(Z)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 137021490 |
| Molecular Formula | C24H17ClN2O4S |
| Molecular Weight | 464.93 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | [4-[(Z)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-chlorobenzoate |
| SMILES | COc1ccc(/N=C2\NC(=O)/C(=C/c3ccc(OC(=O)c4cccc(Cl)c4)cc3)S2)cc1 |
| InChI | InChI=1S/C24H17ClN2O4S/c1-30-19-11-7-18(8-12-19)26-24-27-22(28)21(32-24)13-15-5-9-20(10-6-15)31-23(29)16-3-2-4-17(25)14-16/h2-14H,1H3,(H,26,27,28)/b21-13- |
| InChIKey | GAKFQFSSYQUWOI-BKUYFWCQSA-N |
| XLogP | 5.46 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.93 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|