C24H16BrClN2O4S — CID 137069764
[4-bromo-2-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate (PubChem CID 137069764) has the molecular formula C24H16BrClN2O4S and a molecular weight of 543.83 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [4-bromo-2-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 137069764 |
| Molecular Formula | C24H16BrClN2O4S |
| Molecular Weight | 543.83 g/mol |
| Exact Mass | 541.97 |
| IUPAC Name | [4-bromo-2-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(Br)cc2/C=C2\S/C(=N/c3ccc(Cl)cc3)NC2=O)cc1 |
| InChI | InChI=1S/C24H16BrClN2O4S/c1-31-19-9-2-14(3-10-19)23(30)32-20-11-4-16(25)12-15(20)13-21-22(29)28-24(33-21)27-18-7-5-17(26)6-8-18/h2-13H,1H3,(H,27,28,29)/b21-13- |
| InChIKey | UIBCCAPTSFQXTK-BKUYFWCQSA-N |
| XLogP | 6.22 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.83 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|