C24H17ClN2O3S — CID 137069514
[2-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methylbenzoate (PubChem CID 137069514) has the molecular formula C24H17ClN2O3S and a molecular weight of 448.93 g/mol. Its IUPAC name is [2-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methylbenzoate.
| Compound Name | [2-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 137069514 |
| Molecular Formula | C24H17ClN2O3S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | [2-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccccc2/C=C2\S/C(=N/c3ccc(Cl)cc3)NC2=O)cc1 |
| InChI | InChI=1S/C24H17ClN2O3S/c1-15-6-8-16(9-7-15)23(29)30-20-5-3-2-4-17(20)14-21-22(28)27-24(31-21)26-19-12-10-18(25)11-13-19/h2-14H,1H3,(H,26,27,28)/b21-14- |
| InChIKey | FGDOJAJICJLTDR-STZFKDTASA-N |
| XLogP | 5.76 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|