C24H18N2O3S — CID 137089278
[2-[(Z)-[2-(2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzoate (PubChem CID 137089278) has the molecular formula C24H18N2O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is [2-[(Z)-[2-(2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzoate.
| Compound Name | [2-[(Z)-[2-(2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 137089278 |
| Molecular Formula | C24H18N2O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | [2-[(Z)-[2-(2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzoate |
| SMILES | Cc1ccccc1/N=C1\NC(=O)/C(=C/c2ccccc2OC(=O)c2ccccc2)S1 |
| InChI | InChI=1S/C24H18N2O3S/c1-16-9-5-7-13-19(16)25-24-26-22(27)21(30-24)15-18-12-6-8-14-20(18)29-23(28)17-10-3-2-4-11-17/h2-15H,1H3,(H,25,26,27)/b21-15- |
| InChIKey | QKMCJXOSAXWOHS-QNGOZBTKSA-N |
| XLogP | 5.11 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|