C23H23N3O3S — CID 135892882
(5E)-2-(2-methylphenyl)imino-5-[[2-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 135892882) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is (5E)-2-(2-methylphenyl)imino-5-[[2-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(2-methylphenyl)imino-5-[[2-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135892882 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (5E)-2-(2-methylphenyl)imino-5-[[2-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccccc1/N=C1/NC(=O)/C(=C\c2ccccc2OCC(=O)N2CCCC2)S1 |
| InChI | InChI=1S/C23H23N3O3S/c1-16-8-2-4-10-18(16)24-23-25-22(28)20(30-23)14-17-9-3-5-11-19(17)29-15-21(27)26-12-6-7-13-26/h2-5,8-11,14H,6-7,12-13,15H2,1H3,(H,24,25,28)/b20-14+ |
| InChIKey | UDNBJKWHRIQHBD-XSFVSMFZSA-N |
| XLogP | 3.89 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|