C25H20N2O3S — CID 137166787
[2-[(Z)-[2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzoate (PubChem CID 137166787) has the molecular formula C25H20N2O3S and a molecular weight of 428.51 g/mol. Its IUPAC name is [2-[(Z)-[2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzoate.
| Compound Name | [2-[(Z)-[2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 137166787 |
| Molecular Formula | C25H20N2O3S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | [2-[(Z)-[2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzoate |
| SMILES | Cc1ccc(C)c(/N=C2\NC(=O)/C(=C/c3ccccc3OC(=O)c3ccccc3)S2)c1 |
| InChI | InChI=1S/C25H20N2O3S/c1-16-12-13-17(2)20(14-16)26-25-27-23(28)22(31-25)15-19-10-6-7-11-21(19)30-24(29)18-8-4-3-5-9-18/h3-15H,1-2H3,(H,26,27,28)/b22-15- |
| InChIKey | CVXVOHIHQSZIRX-JCMHNJIXSA-N |
| XLogP | 5.41 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|