C21H19N3O6S — CID 137089355
[4-[(Z)-[2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-3-nitrophenyl] acetate (PubChem CID 137089355) has the molecular formula C21H19N3O6S and a molecular weight of 441.47 g/mol. Its IUPAC name is [4-[(Z)-[2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-3-nitrophenyl] acetate.
| Compound Name | [4-[(Z)-[2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-3-nitrophenyl] acetate |
|---|---|
| PubChem CID | 137089355 |
| Molecular Formula | C21H19N3O6S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | [4-[(Z)-[2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-3-nitrophenyl] acetate |
| SMILES | COc1c(OC(C)=O)ccc(/C=C2\S/C(=N/c3cc(C)ccc3C)NC2=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H19N3O6S/c1-11-5-6-12(2)15(9-11)22-21-23-20(26)17(31-21)10-14-7-8-16(30-13(3)25)19(29-4)18(14)24(27)28/h5-10H,1-4H3,(H,22,23,26)/b17-10- |
| InChIKey | ZHBMNDGQFWKBLO-YVLHZVERSA-N |
| XLogP | 4.04 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|