C20H20N2OS — CID 137089313
(5Z)-2-(2-methylphenyl)imino-5-[(2,4,5-trimethylphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137089313) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is (5Z)-2-(2-methylphenyl)imino-5-[(2,4,5-trimethylphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(2-methylphenyl)imino-5-[(2,4,5-trimethylphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137089313 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (5Z)-2-(2-methylphenyl)imino-5-[(2,4,5-trimethylphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C)c(/C=C2\S/C(=N/c3ccccc3C)NC2=O)cc1C |
| InChI | InChI=1S/C20H20N2OS/c1-12-7-5-6-8-17(12)21-20-22-19(23)18(24-20)11-16-10-14(3)13(2)9-15(16)4/h5-11H,1-4H3,(H,21,22,23)/b18-11- |
| InChIKey | VOOBPFZUBIUDTR-WQRHYEAKSA-N |
| XLogP | 4.81 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|