C23H15ClN2O3S — CID 135533204
[4-[(E)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-chlorobenzoate (PubChem CID 135533204) has the molecular formula C23H15ClN2O3S and a molecular weight of 434.90 g/mol. Its IUPAC name is [4-[(E)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-chlorobenzoate.
| Compound Name | [4-[(E)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 135533204 |
| Molecular Formula | C23H15ClN2O3S |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | [4-[(E)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-chlorobenzoate |
| SMILES | O=C1N/C(=N/c2ccccc2)S/C1=C/c1ccc(OC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H15ClN2O3S/c24-19-9-5-4-8-18(19)22(28)29-17-12-10-15(11-13-17)14-20-21(27)26-23(30-20)25-16-6-2-1-3-7-16/h1-14H,(H,25,26,27)/b20-14+ |
| InChIKey | JHESMKBRSVCFND-XSFVSMFZSA-N |
| XLogP | 5.45 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|