C21H13BrN2O4S — CID 137020065
[4-[(Z)-[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 137020065) has the molecular formula C21H13BrN2O4S and a molecular weight of 469.32 g/mol. Its IUPAC name is [4-[(Z)-[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-[(Z)-[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 137020065 |
| Molecular Formula | C21H13BrN2O4S |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 467.98 |
| IUPAC Name | [4-[(Z)-[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | O=C1N/C(=N\c2ccc(Br)cc2)S/C1=C\c1ccc(OC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C21H13BrN2O4S/c22-14-5-7-15(8-6-14)23-21-24-19(25)18(29-21)12-13-3-9-16(10-4-13)28-20(26)17-2-1-11-27-17/h1-12H,(H,23,24,25)/b18-12- |
| InChIKey | KIVWBKFPFLOJGP-PDGQHHTCSA-N |
| XLogP | 5.15 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|