C22H14N4O6S — CID 137172613
(5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 137172613) has the molecular formula C22H14N4O6S and a molecular weight of 462.44 g/mol. Its IUPAC name is (5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137172613 |
| Molecular Formula | C22H14N4O6S |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | (5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2ccccc2)S/C1=C/c1ccccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H14N4O6S/c27-21-20(33-22(24-21)23-15-7-2-1-3-8-15)12-14-6-4-5-9-18(14)32-19-11-10-16(25(28)29)13-17(19)26(30)31/h1-13H,(H,23,24,27)/b20-12+ |
| InChIKey | XABJPCHBVQTYLJ-UDWIEESQSA-N |
| XLogP | 5.19 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|