C18H14N3O5S- — CID 135676554
2-[(Z)-[2-(2-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-4-nitrophenolate (PubChem CID 135676554) has the molecular formula C18H14N3O5S- and a molecular weight of 384.39 g/mol. Its IUPAC name is 2-[(Z)-[2-(2-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-4-nitrophenolate.
| Compound Name | 2-[(Z)-[2-(2-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 135676554 |
| Molecular Formula | C18H14N3O5S- |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 2-[(Z)-[2-(2-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-4-nitrophenolate |
| SMILES | CCOc1ccccc1/N=C1\NC(=O)/C(=C/c2cc([N+](=O)[O-])ccc2[O-])S1 |
| InChI | InChI=1S/C18H15N3O5S/c1-2-26-15-6-4-3-5-13(15)19-18-20-17(23)16(27-18)10-11-9-12(21(24)25)7-8-14(11)22/h3-10,22H,2H2,1H3,(H,19,20,23)/p-1/b16-10- |
| InChIKey | YQMXCZHCKSSXEK-YBEGLDIGSA-M |
| XLogP | 2.96 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|