C25H18BrCl2N3O5S — CID 137080940
(5E)-5-[[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137080940) has the molecular formula C25H18BrCl2N3O5S and a molecular weight of 623.31 g/mol. Its IUPAC name is (5E)-5-[[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137080940 |
| Molecular Formula | C25H18BrCl2N3O5S |
| Molecular Weight | 623.31 g/mol |
| Exact Mass | 620.95 |
| IUPAC Name | (5E)-5-[[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3cccc(Cl)c3Cl)NC2=O)c(Br)cc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H18BrCl2N3O5S/c1-2-35-20-10-15(17(26)12-21(20)36-13-14-6-8-16(9-7-14)31(33)34)11-22-24(32)30-25(37-22)29-19-5-3-4-18(27)23(19)28/h3-12H,2,13H2,1H3,(H,29,30,32)/b22-11+ |
| InChIKey | BTWIWPQOINWCEA-SSDVNMTOSA-N |
| XLogP | 7.53 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.31 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|