C27H23BrCl2N2O3S — CID 137044225
(5Z)-5-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137044225) has the molecular formula C27H23BrCl2N2O3S and a molecular weight of 606.37 g/mol. Its IUPAC name is (5Z)-5-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137044225 |
| Molecular Formula | C27H23BrCl2N2O3S |
| Molecular Weight | 606.37 g/mol |
| Exact Mass | 604.00 |
| IUPAC Name | (5Z)-5-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\S/C(=N/c3ccc(CC)cc3)NC2=O)c(Br)cc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H23BrCl2N2O3S/c1-3-16-5-8-19(9-6-16)31-27-32-26(33)25(36-27)13-18-12-23(34-4-2)24(14-20(18)28)35-15-17-7-10-21(29)22(30)11-17/h5-14H,3-4,15H2,1-2H3,(H,31,32,33)/b25-13- |
| InChIKey | UFAKRFZQAKIEFV-MXAYSNPKSA-N |
| XLogP | 8.19 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.37 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|