C18H12Br2Cl2N2O3S — CID 137050334
(5E)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137050334) has the molecular formula C18H12Br2Cl2N2O3S and a molecular weight of 567.09 g/mol. Its IUPAC name is (5E)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137050334 |
| Molecular Formula | C18H12Br2Cl2N2O3S |
| Molecular Weight | 567.09 g/mol |
| Exact Mass | 563.83 |
| IUPAC Name | (5E)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3cccc(Cl)c3Cl)NC2=O)c(Br)c(Br)c1O |
| InChI | InChI=1S/C18H12Br2Cl2N2O3S/c1-2-27-11-6-8(13(19)14(20)16(11)25)7-12-17(26)24-18(28-12)23-10-5-3-4-9(21)15(10)22/h3-7,25H,2H2,1H3,(H,23,24,26)/b12-7+ |
| InChIKey | IVANXRAAZNUFBI-KPKJPENVSA-N |
| XLogP | 6.51 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.09 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|