C17H12BrClN2O3S — CID 135527202
(5E)-5-[(2-bromo-3-hydroxy-4-methoxyphenyl)methylidene]-2-(2-chlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135527202) has the molecular formula C17H12BrClN2O3S and a molecular weight of 439.72 g/mol. Its IUPAC name is (5E)-5-[(2-bromo-3-hydroxy-4-methoxyphenyl)methylidene]-2-(2-chlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(2-bromo-3-hydroxy-4-methoxyphenyl)methylidene]-2-(2-chlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135527202 |
| Molecular Formula | C17H12BrClN2O3S |
| Molecular Weight | 439.72 g/mol |
| Exact Mass | 437.94 |
| IUPAC Name | (5E)-5-[(2-bromo-3-hydroxy-4-methoxyphenyl)methylidene]-2-(2-chlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/C=C2/S/C(=N\c3ccccc3Cl)NC2=O)c(Br)c1O |
| InChI | InChI=1S/C17H12BrClN2O3S/c1-24-12-7-6-9(14(18)15(12)22)8-13-16(23)21-17(25-13)20-11-5-3-2-4-10(11)19/h2-8,22H,1H3,(H,20,21,23)/b13-8+ |
| InChIKey | CNXJHQCUMAEMSJ-MDWZMJQESA-N |
| XLogP | 4.71 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.72 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|