C18H13Br2ClN2O3S — CID 137064817
(5Z)-2-(3-chloro-2-methylphenyl)imino-5-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137064817) has the molecular formula C18H13Br2ClN2O3S and a molecular weight of 532.64 g/mol. Its IUPAC name is (5Z)-2-(3-chloro-2-methylphenyl)imino-5-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(3-chloro-2-methylphenyl)imino-5-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137064817 |
| Molecular Formula | C18H13Br2ClN2O3S |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 529.87 |
| IUPAC Name | (5Z)-2-(3-chloro-2-methylphenyl)imino-5-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2\S/C(=N/c3cccc(Cl)c3C)NC2=O)c(Br)c(Br)c1O |
| InChI | InChI=1S/C18H13Br2ClN2O3S/c1-8-10(21)4-3-5-11(8)22-18-23-17(25)13(27-18)7-9-6-12(26-2)16(24)15(20)14(9)19/h3-7,24H,1-2H3,(H,22,23,25)/b13-7- |
| InChIKey | VNPJKRXXBQADGY-QPEQYQDCSA-N |
| XLogP | 5.78 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|