C19H15Br2ClN2O3S — CID 137129140
(5E)-2-(3-chloro-2-methylphenyl)imino-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137129140) has the molecular formula C19H15Br2ClN2O3S and a molecular weight of 546.67 g/mol. Its IUPAC name is (5E)-2-(3-chloro-2-methylphenyl)imino-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(3-chloro-2-methylphenyl)imino-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137129140 |
| Molecular Formula | C19H15Br2ClN2O3S |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 543.89 |
| IUPAC Name | (5E)-2-(3-chloro-2-methylphenyl)imino-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3cccc(Cl)c3C)NC2=O)c(Br)c(Br)c1O |
| InChI | InChI=1S/C19H15Br2ClN2O3S/c1-3-27-13-7-10(15(20)16(21)17(13)25)8-14-18(26)24-19(28-14)23-12-6-4-5-11(22)9(12)2/h4-8,25H,3H2,1-2H3,(H,23,24,26)/b14-8+ |
| InChIKey | JOUQQLANRPMPQY-RIYZIHGNSA-N |
| XLogP | 6.17 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|