C29H21N3O6S — CID 136614305
2-[4-[[5-[[3-[(4-nitrophenyl)methoxy]naphthalen-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid (PubChem CID 136614305) has the molecular formula C29H21N3O6S and a molecular weight of 539.57 g/mol. Its IUPAC name is 2-[4-[[5-[[3-[(4-nitrophenyl)methoxy]naphthalen-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[5-[[3-[(4-nitrophenyl)methoxy]naphthalen-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 136614305 |
| Molecular Formula | C29H21N3O6S |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | 2-[4-[[5-[[3-[(4-nitrophenyl)methoxy]naphthalen-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(/N=C2/NC(=O)C(=Cc3cc4ccccc4cc3OCc3ccc([N+](=O)[O-])cc3)S2)cc1 |
| InChI | InChI=1S/C29H21N3O6S/c33-27(34)13-18-5-9-23(10-6-18)30-29-31-28(35)26(39-29)16-22-14-20-3-1-2-4-21(20)15-25(22)38-17-19-7-11-24(12-8-19)32(36)37/h1-12,14-16H,13,17H2,(H,33,34)(H,30,31,35) |
| InChIKey | NVQNOUMMXOAXHU-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 131.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|