C29H21N3O2S — CID 140534414
2-(1H-indol-5-ylimino)-5-[(3-phenylmethoxynaphthalen-2-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 140534414) has the molecular formula C29H21N3O2S and a molecular weight of 475.57 g/mol. Its IUPAC name is 2-(1H-indol-5-ylimino)-5-[(3-phenylmethoxynaphthalen-2-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-(1H-indol-5-ylimino)-5-[(3-phenylmethoxynaphthalen-2-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 140534414 |
| Molecular Formula | C29H21N3O2S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 2-(1H-indol-5-ylimino)-5-[(3-phenylmethoxynaphthalen-2-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2ccc3[nH]ccc3c2)SC1=Cc1cc2ccccc2cc1OCc1ccccc1 |
| InChI | InChI=1S/C29H21N3O2S/c33-28-27(35-29(32-28)31-24-10-11-25-22(15-24)12-13-30-25)17-23-14-20-8-4-5-9-21(20)16-26(23)34-18-19-6-2-1-3-7-19/h1-17,30H,18H2,(H,31,32,33) |
| InChIKey | ZWBUSRZROZUXSR-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|