C31H26N2O4S — CID 174549927
3-[4-[[4-oxo-5-[(3-phenylmethoxynaphthalen-2-yl)methylidene]-1,3-thiazolidin-2-ylidene]amino]phenyl]butanoic acid (PubChem CID 174549927) has the molecular formula C31H26N2O4S and a molecular weight of 522.63 g/mol. Its IUPAC name is 3-[4-[[4-oxo-5-[(3-phenylmethoxynaphthalen-2-yl)methylidene]-1,3-thiazolidin-2-ylidene]amino]phenyl]butanoic acid.
| Compound Name | 3-[4-[[4-oxo-5-[(3-phenylmethoxynaphthalen-2-yl)methylidene]-1,3-thiazolidin-2-ylidene]amino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 174549927 |
| Molecular Formula | C31H26N2O4S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 3-[4-[[4-oxo-5-[(3-phenylmethoxynaphthalen-2-yl)methylidene]-1,3-thiazolidin-2-ylidene]amino]phenyl]butanoic acid |
| SMILES | CC(CC(=O)O)c1ccc(/N=C2/NC(=O)C(=Cc3cc4ccccc4cc3OCc3ccccc3)S2)cc1 |
| InChI | InChI=1S/C31H26N2O4S/c1-20(15-29(34)35)22-11-13-26(14-12-22)32-31-33-30(36)28(38-31)18-25-16-23-9-5-6-10-24(23)17-27(25)37-19-21-7-3-2-4-8-21/h2-14,16-18,20H,15,19H2,1H3,(H,34,35)(H,32,33,36) |
| InChIKey | BBDJKYUUJBALJJ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|