C31H23N3O4S — CID 136657367
2-[5-[[4-oxo-5-[(3-phenylmethoxynaphthalen-2-yl)methylidene]-1,3-thiazolidin-2-ylidene]amino]indol-1-yl]acetic acid (PubChem CID 136657367) has the molecular formula C31H23N3O4S and a molecular weight of 533.61 g/mol. Its IUPAC name is 2-[5-[[4-oxo-5-[(3-phenylmethoxynaphthalen-2-yl)methylidene]-1,3-thiazolidin-2-ylidene]amino]indol-1-yl]acetic acid.
| Compound Name | 2-[5-[[4-oxo-5-[(3-phenylmethoxynaphthalen-2-yl)methylidene]-1,3-thiazolidin-2-ylidene]amino]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 136657367 |
| Molecular Formula | C31H23N3O4S |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | 2-[5-[[4-oxo-5-[(3-phenylmethoxynaphthalen-2-yl)methylidene]-1,3-thiazolidin-2-ylidene]amino]indol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1ccc2cc(/N=C3/NC(=O)C(=Cc4cc5ccccc5cc4OCc4ccccc4)S3)ccc21 |
| InChI | InChI=1S/C31H23N3O4S/c35-29(36)18-34-13-12-23-15-25(10-11-26(23)34)32-31-33-30(37)28(39-31)17-24-14-21-8-4-5-9-22(21)16-27(24)38-19-20-6-2-1-3-7-20/h1-17H,18-19H2,(H,35,36)(H,32,33,37) |
| InChIKey | WMJLBYZTXIMIDF-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|