C33H28ClN5O3S — CID 135541039
2-[4-[[(5Z)-5-[[2-butyl-5-chloro-3-[[4-(2-cyanophenyl)phenyl]methyl]imidazol-4-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid (PubChem CID 135541039) has the molecular formula C33H28ClN5O3S and a molecular weight of 610.14 g/mol. Its IUPAC name is 2-[4-[[(5Z)-5-[[2-butyl-5-chloro-3-[[4-(2-cyanophenyl)phenyl]methyl]imidazol-4-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[(5Z)-5-[[2-butyl-5-chloro-3-[[4-(2-cyanophenyl)phenyl]methyl]imidazol-4-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 135541039 |
| Molecular Formula | C33H28ClN5O3S |
| Molecular Weight | 610.14 g/mol |
| Exact Mass | 609.16 |
| IUPAC Name | 2-[4-[[(5Z)-5-[[2-butyl-5-chloro-3-[[4-(2-cyanophenyl)phenyl]methyl]imidazol-4-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid |
| SMILES | CCCCc1nc(Cl)c(/C=C2\S/C(=N/c3ccc(CC(=O)O)cc3)NC2=O)n1Cc1ccc(-c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C33H28ClN5O3S/c1-2-3-8-29-37-31(34)27(39(29)20-22-9-13-23(14-10-22)26-7-5-4-6-24(26)19-35)18-28-32(42)38-33(43-28)36-25-15-11-21(12-16-25)17-30(40)41/h4-7,9-16,18H,2-3,8,17,20H2,1H3,(H,40,41)(H,36,38,42)/b28-18- |
| InChIKey | OTZAZBUYJVBQGS-VEILYXNESA-N |
| XLogP | 6.98 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.14 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|