C20H20N4S — CID 10066359
2-[4-[(3-butyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methyl]phenyl]benzonitrile (PubChem CID 10066359) has the molecular formula C20H20N4S and a molecular weight of 348.48 g/mol. Its IUPAC name is 2-[4-[(3-butyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methyl]phenyl]benzonitrile.
| Compound Name | 2-[4-[(3-butyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 10066359 |
| Molecular Formula | C20H20N4S |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-[4-[(3-butyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methyl]phenyl]benzonitrile |
| SMILES | CCCCc1n[nH]c(=S)n1Cc1ccc(-c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C20H20N4S/c1-2-3-8-19-22-23-20(25)24(19)14-15-9-11-16(12-10-15)18-7-5-4-6-17(18)13-21/h4-7,9-12H,2-3,8,14H2,1H3,(H,23,25) |
| InChIKey | PEZCSOJBVDFEAZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 57.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|