C29H27N3O2 — CID 67940236
2-[4-[(2-butyl-6-oxo-4-phenylmethoxypyrimidin-1-yl)methyl]phenyl]benzonitrile (PubChem CID 67940236) has the molecular formula C29H27N3O2 and a molecular weight of 449.55 g/mol. Its IUPAC name is 2-[4-[(2-butyl-6-oxo-4-phenylmethoxypyrimidin-1-yl)methyl]phenyl]benzonitrile.
| Compound Name | 2-[4-[(2-butyl-6-oxo-4-phenylmethoxypyrimidin-1-yl)methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 67940236 |
| Molecular Formula | C29H27N3O2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 2-[4-[(2-butyl-6-oxo-4-phenylmethoxypyrimidin-1-yl)methyl]phenyl]benzonitrile |
| SMILES | CCCCc1nc(OCc2ccccc2)cc(=O)n1Cc1ccc(-c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C29H27N3O2/c1-2-3-13-27-31-28(34-21-23-9-5-4-6-10-23)18-29(33)32(27)20-22-14-16-24(17-15-22)26-12-8-7-11-25(26)19-30/h4-12,14-18H,2-3,13,20-21H2,1H3 |
| InChIKey | ICMQCSYTVULURQ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |