C24H22N2O2S — CID 135619467
(5Z)-2-(3,4-dimethylphenyl)imino-5-[(2-ethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135619467) has the molecular formula C24H22N2O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is (5Z)-2-(3,4-dimethylphenyl)imino-5-[(2-ethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(3,4-dimethylphenyl)imino-5-[(2-ethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135619467 |
| Molecular Formula | C24H22N2O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | (5Z)-2-(3,4-dimethylphenyl)imino-5-[(2-ethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc2ccccc2c1/C=C1\S/C(=N/c2ccc(C)c(C)c2)NC1=O |
| InChI | InChI=1S/C24H22N2O2S/c1-4-28-21-12-10-17-7-5-6-8-19(17)20(21)14-22-23(27)26-24(29-22)25-18-11-9-15(2)16(3)13-18/h5-14H,4H2,1-3H3,(H,25,26,27)/b22-14- |
| InChIKey | IQUUCXBVDGCHPR-HMAPJEAMSA-N |
| XLogP | 5.75 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|