C21H19NO6S — CID 138961586
[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 2-(4-ethoxyphenyl)acetate (PubChem CID 138961586) has the molecular formula C21H19NO6S and a molecular weight of 413.45 g/mol. Its IUPAC name is [4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 2-(4-ethoxyphenyl)acetate.
| Compound Name | [4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 2-(4-ethoxyphenyl)acetate |
|---|---|
| PubChem CID | 138961586 |
| Molecular Formula | C21H19NO6S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | [4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 2-(4-ethoxyphenyl)acetate |
| SMILES | CCOc1ccc(CC(=O)Oc2ccc(C=C3SC(=O)NC3=O)cc2OC)cc1 |
| InChI | InChI=1S/C21H19NO6S/c1-3-27-15-7-4-13(5-8-15)12-19(23)28-16-9-6-14(10-17(16)26-2)11-18-20(24)22-21(25)29-18/h4-11H,3,12H2,1-2H3,(H,22,24,25) |
| InChIKey | YUVXBYLLCCASCC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|