C21H18ClNO7S — CID 138961610
[2-chloro-4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 138961610) has the molecular formula C21H18ClNO7S and a molecular weight of 463.90 g/mol. Its IUPAC name is [2-chloro-4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-(3,4,5-trimethoxyphenyl)acetate.
| Compound Name | [2-chloro-4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-(3,4,5-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 138961610 |
| Molecular Formula | C21H18ClNO7S |
| Molecular Weight | 463.90 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | [2-chloro-4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | COc1cc(CC(=O)Oc2ccc(C=C3SC(=O)NC3=O)cc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C21H18ClNO7S/c1-27-15-7-12(8-16(28-2)19(15)29-3)10-18(24)30-14-5-4-11(6-13(14)22)9-17-20(25)23-21(26)31-17/h4-9H,10H2,1-3H3,(H,23,25,26) |
| InChIKey | WUDAIPVOXFKTIF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.90 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|