C15H14ClNO6S — CID 1232252
ethyl 2-[2-chloro-4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]acetate (PubChem CID 1232252) has the molecular formula C15H14ClNO6S and a molecular weight of 371.80 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[2-chloro-4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 1232252 |
| Molecular Formula | C15H14ClNO6S |
| Molecular Weight | 371.80 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | ethyl 2-[2-chloro-4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(/C=C2/SC(=O)NC2=O)cc1OC |
| InChI | InChI=1S/C15H14ClNO6S/c1-3-22-12(18)7-23-13-9(16)4-8(5-10(13)21-2)6-11-14(19)17-15(20)24-11/h4-6H,3,7H2,1-2H3,(H,17,19,20)/b11-6+ |
| InChIKey | FMXZTWIOZCGHES-IZZDOVSWSA-N |
| XLogP | 2.61 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.80 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|