C18H11BrClNO4S — CID 138961509
[2-bromo-4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-(3-chlorophenyl)acetate (PubChem CID 138961509) has the molecular formula C18H11BrClNO4S and a molecular weight of 452.71 g/mol. Its IUPAC name is [2-bromo-4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-(3-chlorophenyl)acetate.
| Compound Name | [2-bromo-4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-(3-chlorophenyl)acetate |
|---|---|
| PubChem CID | 138961509 |
| Molecular Formula | C18H11BrClNO4S |
| Molecular Weight | 452.71 g/mol |
| Exact Mass | 450.93 |
| IUPAC Name | [2-bromo-4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-(3-chlorophenyl)acetate |
| SMILES | O=C(Cc1cccc(Cl)c1)Oc1ccc(C=C2SC(=O)NC2=O)cc1Br |
| InChI | InChI=1S/C18H11BrClNO4S/c19-13-7-11(8-15-17(23)21-18(24)26-15)4-5-14(13)25-16(22)9-10-2-1-3-12(20)6-10/h1-8H,9H2,(H,21,23,24) |
| InChIKey | YPSAYESNNSULFZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.71 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|