C20H22BrNO4S — CID 137405423
[2-bromo-4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-cyclohexylbutanoate (PubChem CID 137405423) has the molecular formula C20H22BrNO4S and a molecular weight of 452.37 g/mol. Its IUPAC name is [2-bromo-4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-cyclohexylbutanoate.
| Compound Name | [2-bromo-4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-cyclohexylbutanoate |
|---|---|
| PubChem CID | 137405423 |
| Molecular Formula | C20H22BrNO4S |
| Molecular Weight | 452.37 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | [2-bromo-4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-cyclohexylbutanoate |
| SMILES | O=C(CCCC1CCCCC1)Oc1ccc(C=C2SC(=O)NC2=O)cc1Br |
| InChI | InChI=1S/C20H22BrNO4S/c21-15-11-14(12-17-19(24)22-20(25)27-17)9-10-16(15)26-18(23)8-4-7-13-5-2-1-3-6-13/h9-13H,1-8H2,(H,22,24,25) |
| InChIKey | FXFGYJZVZFVZIH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.37 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|