C18H12BrNO4S — CID 130222562
[2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-phenylacetate (PubChem CID 130222562) has the molecular formula C18H12BrNO4S and a molecular weight of 418.27 g/mol. Its IUPAC name is [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-phenylacetate.
| Compound Name | [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-phenylacetate |
|---|---|
| PubChem CID | 130222562 |
| Molecular Formula | C18H12BrNO4S |
| Molecular Weight | 418.27 g/mol |
| Exact Mass | 416.97 |
| IUPAC Name | [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-phenylacetate |
| SMILES | O=C(Cc1ccccc1)Oc1ccc(/C=C2\SC(=O)NC2=O)cc1Br |
| InChI | InChI=1S/C18H12BrNO4S/c19-13-8-12(9-15-17(22)20-18(23)25-15)6-7-14(13)24-16(21)10-11-4-2-1-3-5-11/h1-9H,10H2,(H,20,22,23)/b15-9- |
| InChIKey | UHQSQSADJKQNJZ-DHDCSXOGSA-N |
| XLogP | 3.92 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|