C26H20ClNO6S — CID 160740022
[2-chloro-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-phenylacetate;2-phenylacetic acid (PubChem CID 160740022) has the molecular formula C26H20ClNO6S and a molecular weight of 509.97 g/mol. Its IUPAC name is [2-chloro-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-phenylacetate;2-phenylacetic acid.
| Compound Name | [2-chloro-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-phenylacetate;2-phenylacetic acid |
|---|---|
| PubChem CID | 160740022 |
| Molecular Formula | C26H20ClNO6S |
| Molecular Weight | 509.97 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | [2-chloro-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-phenylacetate;2-phenylacetic acid |
| SMILES | O=C(Cc1ccccc1)Oc1ccc(/C=C2\SC(=O)NC2=O)cc1Cl.O=C(O)Cc1ccccc1 |
| InChI | InChI=1S/C18H12ClNO4S.C8H8O2/c19-13-8-12(9-15-17(22)20-18(23)25-15)6-7-14(13)24-16(21)10-11-4-2-1-3-5-11;9-8(10)6-7-4-2-1-3-5-7/h1-9H,10H2,(H,20,22,23);1-5H,6H2,(H,9,10)/b15-9-; |
| InChIKey | RVLKAYVFHVEABF-SOCRLDLMSA-N |
| XLogP | 5.13 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.97 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|