C22H19BrClN3O4S — CID 137155951
(5Z)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-2-(3-chlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137155951) has the molecular formula C22H19BrClN3O4S and a molecular weight of 536.84 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-2-(3-chlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-2-(3-chlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137155951 |
| Molecular Formula | C22H19BrClN3O4S |
| Molecular Weight | 536.84 g/mol |
| Exact Mass | 535.00 |
| IUPAC Name | (5Z)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-2-(3-chlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2cccc(Cl)c2)S/C1=C\c1ccc(OCC(=O)N2CCOCC2)c(Br)c1 |
| InChI | InChI=1S/C22H19BrClN3O4S/c23-17-10-14(4-5-18(17)31-13-20(28)27-6-8-30-9-7-27)11-19-21(29)26-22(32-19)25-16-3-1-2-15(24)12-16/h1-5,10-12H,6-9,13H2,(H,25,26,29)/b19-11- |
| InChIKey | RZFOSWMUJRSLCN-ODLFYWEKSA-N |
| XLogP | 4.23 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.84 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|