C12H8N4O6 — CID 30619595
5-[(7-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1H-pyrimidine-2,4-dione (PubChem CID 30619595) has the molecular formula C12H8N4O6 and a molecular weight of 304.22 g/mol. Its IUPAC name is 5-[(7-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(7-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 30619595 |
| Molecular Formula | C12H8N4O6 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 5-[(7-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(/N=C/c2cc3c(c([N+](=O)[O-])c2)OCO3)c(=O)[nH]1 |
| InChI | InChI=1S/C12H8N4O6/c17-11-7(4-14-12(18)15-11)13-3-6-1-8(16(19)20)10-9(2-6)21-5-22-10/h1-4H,5H2,(H2,14,15,17,18)/b13-3+ |
| InChIKey | DRKYVBOJSSLSSN-QLKAYGNNSA-N |
| XLogP | 0.45 |
| TPSA | 139.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|