C15H11N7O4 — CID 139060092
5-[[6-[(2,4-dioxo-1H-pyrimidin-5-yl)iminomethyl]-2-pyridinyl]methylideneamino]-1H-pyrimidine-2,4-dione (PubChem CID 139060092) has the molecular formula C15H11N7O4 and a molecular weight of 353.30 g/mol. Its IUPAC name is 5-[[6-[(2,4-dioxo-1H-pyrimidin-5-yl)iminomethyl]-2-pyridinyl]methylideneamino]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[[6-[(2,4-dioxo-1H-pyrimidin-5-yl)iminomethyl]-2-pyridinyl]methylideneamino]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139060092 |
| Molecular Formula | C15H11N7O4 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 5-[[6-[(2,4-dioxo-1H-pyrimidin-5-yl)iminomethyl]-2-pyridinyl]methylideneamino]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(/N=C/c2cccc(/C=N/c3c[nH]c(=O)[nH]c3=O)n2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H11N7O4/c23-12-10(6-18-14(25)21-12)16-4-8-2-1-3-9(20-8)5-17-11-7-19-15(26)22-13(11)24/h1-7H,(H2,18,21,23,25)(H2,19,22,24,26)/b16-4+,17-5+ |
| InChIKey | CEXJJQMZZUDEGQ-KOVNFMEWSA-N |
| XLogP | -0.66 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|