C32H21F6N3O3S2 — CID 137258573
5-[[5-[4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]-2-hydroxyphenyl]methylideneamino]-1H-pyrimidine-2,4-dione (PubChem CID 137258573) has the molecular formula C32H21F6N3O3S2 and a molecular weight of 673.66 g/mol. Its IUPAC name is 5-[[5-[4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]-2-hydroxyphenyl]methylideneamino]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[[5-[4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]-2-hydroxyphenyl]methylideneamino]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137258573 |
| Molecular Formula | C32H21F6N3O3S2 |
| Molecular Weight | 673.66 g/mol |
| Exact Mass | 673.09 |
| IUPAC Name | 5-[[5-[4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]-2-hydroxyphenyl]methylideneamino]-1H-pyrimidine-2,4-dione |
| SMILES | Cc1sc(-c2ccccc2)cc1C1=C(c2cc(-c3ccc(O)c(/C=N/c4c[nH]c(=O)[nH]c4=O)c3)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C32H21F6N3O3S2/c1-15-20(11-24(45-15)17-6-4-3-5-7-17)26-27(31(35,36)32(37,38)30(26,33)34)21-12-25(46-16(21)2)18-8-9-23(42)19(10-18)13-39-22-14-40-29(44)41-28(22)43/h3-14,42H,1-2H3,(H2,40,41,43,44)/b39-13+ |
| InChIKey | BRQXNQZDHDLTPT-BUADGAHVSA-N |
| XLogP | 8.42 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.66 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|