C23H13F9S — CID 102577266
3-[3,3,4,4,5,5-hexafluoro-2-[2-(trifluoromethyl)phenyl]cyclopenten-1-yl]-2-methyl-5-phenylthiophene (PubChem CID 102577266) has the molecular formula C23H13F9S and a molecular weight of 492.41 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-[2-(trifluoromethyl)phenyl]cyclopenten-1-yl]-2-methyl-5-phenylthiophene.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-[2-(trifluoromethyl)phenyl]cyclopenten-1-yl]-2-methyl-5-phenylthiophene |
|---|---|
| PubChem CID | 102577266 |
| Molecular Formula | C23H13F9S |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-[2-(trifluoromethyl)phenyl]cyclopenten-1-yl]-2-methyl-5-phenylthiophene |
| SMILES | Cc1sc(-c2ccccc2)cc1C1=C(c2ccccc2C(F)(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C23H13F9S/c1-12-15(11-17(33-12)13-7-3-2-4-8-13)19-18(20(24,25)23(31,32)21(19,26)27)14-9-5-6-10-16(14)22(28,29)30/h2-11H,1H3 |
| InChIKey | SJBFJELRBBHFEF-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|