C17H10F6OS — CID 59420013
3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopentene-1-carbaldehyde (PubChem CID 59420013) has the molecular formula C17H10F6OS and a molecular weight of 376.32 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopentene-1-carbaldehyde.
| Compound Name | 3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopentene-1-carbaldehyde |
|---|---|
| PubChem CID | 59420013 |
| Molecular Formula | C17H10F6OS |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopentene-1-carbaldehyde |
| SMILES | Cc1sc(-c2ccccc2)cc1C1=C(C=O)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C17H10F6OS/c1-9-11(7-13(25-9)10-5-3-2-4-6-10)14-12(8-24)15(18,19)17(22,23)16(14,20)21/h2-8H,1H3 |
| InChIKey | LLYVXLINTOFQGJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|