C17H14F4S — CID 143334929
2-methyl-5-phenyl-3-(4,4,5,5-tetrafluoro-2-methylcyclopenten-1-yl)thiophene (PubChem CID 143334929) has the molecular formula C17H14F4S and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-methyl-5-phenyl-3-(4,4,5,5-tetrafluoro-2-methylcyclopenten-1-yl)thiophene.
| Compound Name | 2-methyl-5-phenyl-3-(4,4,5,5-tetrafluoro-2-methylcyclopenten-1-yl)thiophene |
|---|---|
| PubChem CID | 143334929 |
| Molecular Formula | C17H14F4S |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-methyl-5-phenyl-3-(4,4,5,5-tetrafluoro-2-methylcyclopenten-1-yl)thiophene |
| SMILES | CC1=C(c2cc(-c3ccccc3)sc2C)C(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C17H14F4S/c1-10-9-16(18,19)17(20,21)15(10)13-8-14(22-11(13)2)12-6-4-3-5-7-12/h3-8H,9H2,1-2H3 |
| InChIKey | GXNPUNPJJYQJSE-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|