C25H14F6S2 — CID 102497315
2,5-diethynyl-3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-4-methylthiophene (PubChem CID 102497315) has the molecular formula C25H14F6S2 and a molecular weight of 492.51 g/mol. Its IUPAC name is 2,5-diethynyl-3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-4-methylthiophene.
| Compound Name | 2,5-diethynyl-3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-4-methylthiophene |
|---|---|
| PubChem CID | 102497315 |
| Molecular Formula | C25H14F6S2 |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | 2,5-diethynyl-3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-4-methylthiophene |
| SMILES | C#Cc1sc(C#C)c(C2=C(c3cc(-c4ccccc4)sc3C)C(F)(F)C(F)(F)C2(F)F)c1C |
| InChI | InChI=1S/C25H14F6S2/c1-5-17-13(3)20(18(6-2)33-17)22-21(23(26,27)25(30,31)24(22,28)29)16-12-19(32-14(16)4)15-10-8-7-9-11-15/h1-2,7-12H,3-4H3 |
| InChIKey | MWXXMASJBSXBEL-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|