C25H17F6NOS — CID 102583654
4-[4-[2-(2-ethyl-1-benzofuran-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]pyridine (PubChem CID 102583654) has the molecular formula C25H17F6NOS and a molecular weight of 493.47 g/mol. Its IUPAC name is 4-[4-[2-(2-ethyl-1-benzofuran-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]pyridine.
| Compound Name | 4-[4-[2-(2-ethyl-1-benzofuran-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]pyridine |
|---|---|
| PubChem CID | 102583654 |
| Molecular Formula | C25H17F6NOS |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 4-[4-[2-(2-ethyl-1-benzofuran-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]pyridine |
| SMILES | CCc1oc2ccccc2c1C1=C(c2cc(-c3ccncc3)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C25H17F6NOS/c1-3-17-20(15-6-4-5-7-18(15)33-17)22-21(23(26,27)25(30,31)24(22,28)29)16-12-19(34-13(16)2)14-8-10-32-11-9-14/h4-12H,3H2,1-2H3 |
| InChIKey | LODADTABUISHFL-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|