C37H32F6N2O2S — CID 139246227
5-(diethylamino)-2-[[4-[4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzofuran-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]phenyl]methyliminomethyl]phenol (PubChem CID 139246227) has the molecular formula C37H32F6N2O2S and a molecular weight of 682.73 g/mol. Its IUPAC name is 5-(diethylamino)-2-[[4-[4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzofuran-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]phenyl]methyliminomethyl]phenol.
| Compound Name | 5-(diethylamino)-2-[[4-[4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzofuran-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]phenyl]methyliminomethyl]phenol |
|---|---|
| PubChem CID | 139246227 |
| Molecular Formula | C37H32F6N2O2S |
| Molecular Weight | 682.73 g/mol |
| Exact Mass | 682.21 |
| IUPAC Name | 5-(diethylamino)-2-[[4-[4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzofuran-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]phenyl]methyliminomethyl]phenol |
| SMILES | CCN(CC)c1ccc(/C=N/Cc2ccc(-c3cc(C4=C(c5c(C)oc6ccccc56)C(F)(F)C(F)(F)C4(F)F)c(C)s3)cc2)c(O)c1 |
| InChI | InChI=1S/C37H32F6N2O2S/c1-5-45(6-2)26-16-15-25(29(46)17-26)20-44-19-23-11-13-24(14-12-23)31-18-28(22(4)48-31)33-34(36(40,41)37(42,43)35(33,38)39)32-21(3)47-30-10-8-7-9-27(30)32/h7-18,20,46H,5-6,19H2,1-4H3/b44-20+ |
| InChIKey | TXFTZKIYRFFFGO-JTDVPQLKSA-N |
| XLogP | 10.78 |
| TPSA | 48.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.73 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|