C21H28N2O4 — CID 135710898
5-(diethylamino)-2-[(3,4,5-trimethoxyphenyl)methyliminomethyl]phenol (PubChem CID 135710898) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 5-(diethylamino)-2-[(3,4,5-trimethoxyphenyl)methyliminomethyl]phenol.
| Compound Name | 5-(diethylamino)-2-[(3,4,5-trimethoxyphenyl)methyliminomethyl]phenol |
|---|---|
| PubChem CID | 135710898 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 5-(diethylamino)-2-[(3,4,5-trimethoxyphenyl)methyliminomethyl]phenol |
| SMILES | CCN(CC)c1ccc(/C=N/Cc2cc(OC)c(OC)c(OC)c2)c(O)c1 |
| InChI | InChI=1S/C21H28N2O4/c1-6-23(7-2)17-9-8-16(18(24)12-17)14-22-13-15-10-19(25-3)21(27-5)20(11-15)26-4/h8-12,14,24H,6-7,13H2,1-5H3/b22-14+ |
| InChIKey | OKJSROAFWYGNPY-HYARGMPZSA-N |
| XLogP | 3.88 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|