C20H27N3O4S — CID 135774521
5-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-methoxy-N,N-dimethylbenzenesulfonamide (PubChem CID 135774521) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is 5-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-methoxy-N,N-dimethylbenzenesulfonamide.
| Compound Name | 5-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-methoxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 135774521 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 5-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-methoxy-N,N-dimethylbenzenesulfonamide |
| SMILES | CCN(CC)c1ccc(/C=N/c2ccc(OC)c(S(=O)(=O)N(C)C)c2)c(O)c1 |
| InChI | InChI=1S/C20H27N3O4S/c1-6-23(7-2)17-10-8-15(18(24)13-17)14-21-16-9-11-19(27-5)20(12-16)28(25,26)22(3)4/h8-14,24H,6-7H2,1-5H3/b21-14+ |
| InChIKey | JYXIIQKJFPVMIY-KGENOOAVSA-N |
| XLogP | 3.25 |
| TPSA | 82.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|