C16H17ClN2O4S — CID 135758621
5-[(5-chloro-2-hydroxyphenyl)methylideneamino]-2-methoxy-N,N-dimethylbenzenesulfonamide (PubChem CID 135758621) has the molecular formula C16H17ClN2O4S and a molecular weight of 368.84 g/mol. Its IUPAC name is 5-[(5-chloro-2-hydroxyphenyl)methylideneamino]-2-methoxy-N,N-dimethylbenzenesulfonamide.
| Compound Name | 5-[(5-chloro-2-hydroxyphenyl)methylideneamino]-2-methoxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 135758621 |
| Molecular Formula | C16H17ClN2O4S |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 5-[(5-chloro-2-hydroxyphenyl)methylideneamino]-2-methoxy-N,N-dimethylbenzenesulfonamide |
| SMILES | COc1ccc(/N=C/c2cc(Cl)ccc2O)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C16H17ClN2O4S/c1-19(2)24(21,22)16-9-13(5-7-15(16)23-3)18-10-11-8-12(17)4-6-14(11)20/h4-10,20H,1-3H3/b18-10+ |
| InChIKey | SGBPGAWUKANNQN-VCHYOVAHSA-N |
| XLogP | 3.06 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|