C21H30N3O+ — CID 135829092
[2-[[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]methyl]phenyl]methyl-dimethylazanium (PubChem CID 135829092) has the molecular formula C21H30N3O+ and a molecular weight of 340.49 g/mol. Its IUPAC name is [2-[[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]methyl]phenyl]methyl-dimethylazanium.
| Compound Name | [2-[[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]methyl]phenyl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 135829092 |
| Molecular Formula | C21H30N3O+ |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | [2-[[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]methyl]phenyl]methyl-dimethylazanium |
| SMILES | CCN(CC)c1ccc(/C=N/Cc2ccccc2C[NH+](C)C)c(O)c1 |
| InChI | InChI=1S/C21H29N3O/c1-5-24(6-2)20-12-11-18(21(25)13-20)15-22-14-17-9-7-8-10-19(17)16-23(3)4/h7-13,15,25H,5-6,14,16H2,1-4H3/p+1/b22-15+ |
| InChIKey | GNOUMOIOTCEEJZ-PXLXIMEGSA-O |
| XLogP | 2.50 |
| TPSA | 40.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|